C21H24N2OSi — CID 139910624
(4S)-4-[tert-butyl(diphenyl)silyl]oxy-3,4-dihydro-2H-pyrrole-5-carbonitrile (PubChem CID 139910624) has the molecular formula C21H24N2OSi and a molecular weight of 348.52 g/mol. Its IUPAC name is (4S)-4-[tert-butyl(diphenyl)silyl]oxy-3,4-dihydro-2H-pyrrole-5-carbonitrile.
| Compound Name | (4S)-4-[tert-butyl(diphenyl)silyl]oxy-3,4-dihydro-2H-pyrrole-5-carbonitrile |
|---|---|
| PubChem CID | 139910624 |
| Molecular Formula | C21H24N2OSi |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | (4S)-4-[tert-butyl(diphenyl)silyl]oxy-3,4-dihydro-2H-pyrrole-5-carbonitrile |
| SMILES | CC(C)(C)[Si](O[C@H]1CCN=C1C#N)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H24N2OSi/c1-21(2,3)25(17-10-6-4-7-11-17,18-12-8-5-9-13-18)24-20-14-15-23-19(20)16-22/h4-13,20H,14-15H2,1-3H3/t20-/m0/s1 |
| InChIKey | ZMIZQIRMDGLQFF-FQEVSTJZSA-N |
| XLogP | 3.30 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|