C24H22F11N2O8S3+ — CID 139967694
[6-ethenyl-2-[1-(4-ethenylphenoxy)-1,2,2,2-tetrafluoroethyl]sulfonyl-3-[1,2,2,2-tetrafluoro-1-(trifluoromethylsulfonylsulfamoyl)ethoxy]phenyl]-trimethylazanium (PubChem CID 139967694) has the molecular formula C24H22F11N2O8S3+ and a molecular weight of 771.62 g/mol. Its IUPAC name is [6-ethenyl-2-[1-(4-ethenylphenoxy)-1,2,2,2-tetrafluoroethyl]sulfonyl-3-[1,2,2,2-tetrafluoro-1-(trifluoromethylsulfonylsulfamoyl)ethoxy]phenyl]-trimethylazanium.
| Compound Name | [6-ethenyl-2-[1-(4-ethenylphenoxy)-1,2,2,2-tetrafluoroethyl]sulfonyl-3-[1,2,2,2-tetrafluoro-1-(trifluoromethylsulfonylsulfamoyl)ethoxy]phenyl]-trimethylazanium |
|---|---|
| PubChem CID | 139967694 |
| Molecular Formula | C24H22F11N2O8S3+ |
| Molecular Weight | 771.62 g/mol |
| Exact Mass | 771.04 |
| IUPAC Name | [6-ethenyl-2-[1-(4-ethenylphenoxy)-1,2,2,2-tetrafluoroethyl]sulfonyl-3-[1,2,2,2-tetrafluoro-1-(trifluoromethylsulfonylsulfamoyl)ethoxy]phenyl]-trimethylazanium |
| SMILES | C=Cc1ccc(OC(F)(C(F)(F)F)S(=O)(=O)c2c(OC(F)(C(F)(F)F)S(=O)(=O)NS(=O)(=O)C(F)(F)F)ccc(C=C)c2[N+](C)(C)C)cc1 |
| InChI | InChI=1S/C24H22F11N2O8S3/c1-6-14-8-11-16(12-9-14)44-22(31,20(25,26)27)46(38,39)19-17(13-10-15(7-2)18(19)37(3,4)5)45-23(32,21(28,29)30)47(40,41)36-48(42,43)24(33,34)35/h6-13,36H,1-2H2,3-5H3/q+1 |
| InChIKey | OIYUDHSWLWHAPX-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 132.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.62 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|