C23H31N3O2S — CID 139977549
(E)-7-[(1S,2S,3S,4R)-3-[(E)-N-(N-carbamothioylanilino)-C-methylcarbonimidoyl]-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid (PubChem CID 139977549) has the molecular formula C23H31N3O2S and a molecular weight of 413.59 g/mol. Its IUPAC name is (E)-7-[(1S,2S,3S,4R)-3-[(E)-N-(N-carbamothioylanilino)-C-methylcarbonimidoyl]-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid.
| Compound Name | (E)-7-[(1S,2S,3S,4R)-3-[(E)-N-(N-carbamothioylanilino)-C-methylcarbonimidoyl]-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 139977549 |
| Molecular Formula | C23H31N3O2S |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | (E)-7-[(1S,2S,3S,4R)-3-[(E)-N-(N-carbamothioylanilino)-C-methylcarbonimidoyl]-2-bicyclo[2.2.1]heptanyl]hept-5-enoic acid |
| SMILES | C/C(=N\N(C(N)=S)c1ccccc1)[C@H]1[C@@H]2CC[C@@H](C2)[C@@H]1C/C=C/CCCC(=O)O |
| InChI | InChI=1S/C23H31N3O2S/c1-16(25-26(23(24)29)19-9-5-4-6-10-19)22-18-14-13-17(15-18)20(22)11-7-2-3-8-12-21(27)28/h2,4-7,9-10,17-18,20,22H,3,8,11-15H2,1H3,(H2,24,29)(H,27,28)/b7-2+,25-16+/t17-,18+,20-,22-/m0/s1 |
| InChIKey | QJMQQJJBPMFIJG-XYUHORQMSA-N |
| XLogP | 4.98 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|