C17H19N5O2 — CID 140557581
3-amino-1-(9,9-dimethylfluoren-2-yl)-1-(hydrazinecarbonyl)urea (PubChem CID 140557581) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is 3-amino-1-(9,9-dimethylfluoren-2-yl)-1-(hydrazinecarbonyl)urea.
| Compound Name | 3-amino-1-(9,9-dimethylfluoren-2-yl)-1-(hydrazinecarbonyl)urea |
|---|---|
| PubChem CID | 140557581 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 3-amino-1-(9,9-dimethylfluoren-2-yl)-1-(hydrazinecarbonyl)urea |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(C(=O)NN)C(=O)NN)cc21 |
| InChI | InChI=1S/C17H19N5O2/c1-17(2)13-6-4-3-5-11(13)12-8-7-10(9-14(12)17)22(15(23)20-18)16(24)21-19/h3-9H,18-19H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | LDZBRVBIYALKLG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|