C19H29N5O7S2 — CID 140606286
2-[2-[carboxymethyl-[2-[carboxymethyl-[2-oxo-2-[2-(pyridin-2-yldisulfanyl)ethylamino]ethyl]amino]ethyl]amino]ethylamino]acetic acid (PubChem CID 140606286) has the molecular formula C19H29N5O7S2 and a molecular weight of 503.60 g/mol. Its IUPAC name is 2-[2-[carboxymethyl-[2-[carboxymethyl-[2-oxo-2-[2-(pyridin-2-yldisulfanyl)ethylamino]ethyl]amino]ethyl]amino]ethylamino]acetic acid.
| Compound Name | 2-[2-[carboxymethyl-[2-[carboxymethyl-[2-oxo-2-[2-(pyridin-2-yldisulfanyl)ethylamino]ethyl]amino]ethyl]amino]ethylamino]acetic acid |
|---|---|
| PubChem CID | 140606286 |
| Molecular Formula | C19H29N5O7S2 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | 2-[2-[carboxymethyl-[2-[carboxymethyl-[2-oxo-2-[2-(pyridin-2-yldisulfanyl)ethylamino]ethyl]amino]ethyl]amino]ethylamino]acetic acid |
| SMILES | O=C(O)CNCCN(CCN(CC(=O)O)CC(=O)NCCSSc1ccccn1)CC(=O)O |
| InChI | InChI=1S/C19H29N5O7S2/c25-15(21-6-10-32-33-16-3-1-2-4-22-16)12-24(14-19(30)31)9-8-23(13-18(28)29)7-5-20-11-17(26)27/h1-4,20H,5-14H2,(H,21,25)(H,26,27)(H,28,29)(H,30,31) |
| InChIKey | MXRHTJQAXGOJFA-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 172.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|