C16H29N2O4 — CID 140670852
CID 140670852 (PubChem CID 140670852) has the molecular formula C16H29N2O4 and a molecular weight of 313.42 g/mol.
| Compound Name | CID 140670852 |
|---|---|
| PubChem CID | 140670852 |
| Molecular Formula | C16H29N2O4 |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.21 |
| IUPAC Name | — |
| SMILES | C=C(C)C(=O)OCC(O)CNC1CC(C)(C)N([O])C(C)(C)C1 |
| InChI | InChI=1S/C16H29N2O4/c1-11(2)14(20)22-10-13(19)9-17-12-7-15(3,4)18(21)16(5,6)8-12/h12-13,17,19H,1,7-10H2,2-6H3 |
| InChIKey | WJGOJFHTTSNFDK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|