C16H30N2O3S — CID 144823885
[2-hydroxy-3-[(2,2,6,6-tetramethyl-1-sulfanylpiperidin-4-yl)amino]propyl] 2-methylprop-2-enoate (PubChem CID 144823885) has the molecular formula C16H30N2O3S and a molecular weight of 330.49 g/mol. Its IUPAC name is [2-hydroxy-3-[(2,2,6,6-tetramethyl-1-sulfanylpiperidin-4-yl)amino]propyl] 2-methylprop-2-enoate.
| Compound Name | [2-hydroxy-3-[(2,2,6,6-tetramethyl-1-sulfanylpiperidin-4-yl)amino]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 144823885 |
| Molecular Formula | C16H30N2O3S |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | [2-hydroxy-3-[(2,2,6,6-tetramethyl-1-sulfanylpiperidin-4-yl)amino]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)CNC1CC(C)(C)N(S)C(C)(C)C1 |
| InChI | InChI=1S/C16H30N2O3S/c1-11(2)14(20)21-10-13(19)9-17-12-7-15(3,4)18(22)16(5,6)8-12/h12-13,17,19,22H,1,7-10H2,2-6H3 |
| InChIKey | GEILJFVIYOYLAU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|