C19H17NSi — CID 140720291
5,5-dimethyl-3-(3,4,5-trideuteriophenyl)-[1]benzosilolo[3,2-c]pyridine (PubChem CID 140720291) has the molecular formula C19H17NSi and a molecular weight of 290.46 g/mol. Its IUPAC name is 5,5-dimethyl-3-(3,4,5-trideuteriophenyl)-[1]benzosilolo[3,2-c]pyridine.
| Compound Name | 5,5-dimethyl-3-(3,4,5-trideuteriophenyl)-[1]benzosilolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 140720291 |
| Molecular Formula | C19H17NSi |
| Molecular Weight | 290.46 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 5,5-dimethyl-3-(3,4,5-trideuteriophenyl)-[1]benzosilolo[3,2-c]pyridine |
| SMILES | [2H]c1cc(-c2cc3c(cn2)-c2ccccc2[Si]3(C)C)cc([2H])c1[2H] |
| InChI | InChI=1S/C19H17NSi/c1-21(2)18-11-7-6-10-15(18)16-13-20-17(12-19(16)21)14-8-4-3-5-9-14/h3-13H,1-2H3/i3D,4D,5D |
| InChIKey | GXRGPKYZRPTKOZ-QGZYMEECSA-N |
| XLogP | 3.55 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|