C5H9NO2S — CID 140739347
(2S,4S)-4-azaniumylthiolane-2-carboxylate (PubChem CID 140739347) has the molecular formula C5H9NO2S and a molecular weight of 147.20 g/mol. Its IUPAC name is (2S,4S)-4-azaniumylthiolane-2-carboxylate.
| Compound Name | (2S,4S)-4-azaniumylthiolane-2-carboxylate |
|---|---|
| PubChem CID | 140739347 |
| Molecular Formula | C5H9NO2S |
| Molecular Weight | 147.20 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | (2S,4S)-4-azaniumylthiolane-2-carboxylate |
| SMILES | [NH3+][C@@H]1CS[C@H](C(=O)[O-])C1 |
| InChI | InChI=1S/C5H9NO2S/c6-3-1-4(5(7)8)9-2-3/h3-4H,1-2,6H2,(H,7,8)/t3-,4-/m0/s1 |
| InChIKey | DHQBUVNDDNLKOA-IMJSIDKUSA-N |
| XLogP | -2.15 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.20 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |