C26H17F6O7S- — CID 140782593
5-[6-hydroxy-4-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylnaphthalen-1-yl]naphthalene-1-sulfonate (PubChem CID 140782593) has the molecular formula C26H17F6O7S- and a molecular weight of 587.47 g/mol. Its IUPAC name is 5-[6-hydroxy-4-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylnaphthalen-1-yl]naphthalene-1-sulfonate.
| Compound Name | 5-[6-hydroxy-4-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylnaphthalen-1-yl]naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 140782593 |
| Molecular Formula | C26H17F6O7S- |
| Molecular Weight | 587.47 g/mol |
| Exact Mass | 587.06 |
| IUPAC Name | 5-[6-hydroxy-4-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylnaphthalen-1-yl]naphthalene-1-sulfonate |
| SMILES | O=C(OCCC(O)(C(F)(F)F)C(F)(F)F)c1ccc(-c2cccc3c(S(=O)(=O)[O-])cccc23)c2ccc(O)cc12 |
| InChI | InChI=1S/C26H18F6O7S/c27-25(28,29)24(35,26(30,31)32)11-12-39-23(34)20-10-9-17(18-8-7-14(33)13-21(18)20)15-3-1-5-19-16(15)4-2-6-22(19)40(36,37)38/h1-10,13,33,35H,11-12H2,(H,36,37,38)/p-1 |
| InChIKey | ATOLSZQKVPTTSG-UHFFFAOYSA-M |
| XLogP | 5.67 |
| TPSA | 123.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.47 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|