C9H8BNO6 — CID 140793262
6-hydroxy-8-(nitromethyl)-8H-[1,3]dioxolo[4,5-e][2,1]benzoxaborole (PubChem CID 140793262) has the molecular formula C9H8BNO6 and a molecular weight of 236.98 g/mol. Its IUPAC name is 6-hydroxy-8-(nitromethyl)-8H-[1,3]dioxolo[4,5-e][2,1]benzoxaborole.
| Compound Name | 6-hydroxy-8-(nitromethyl)-8H-[1,3]dioxolo[4,5-e][2,1]benzoxaborole |
|---|---|
| PubChem CID | 140793262 |
| Molecular Formula | C9H8BNO6 |
| Molecular Weight | 236.98 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 6-hydroxy-8-(nitromethyl)-8H-[1,3]dioxolo[4,5-e][2,1]benzoxaborole |
| SMILES | O=[N+]([O-])CC1OB(O)c2ccc3c(c21)OCO3 |
| InChI | InChI=1S/C9H8BNO6/c12-10-5-1-2-6-9(16-4-15-6)8(5)7(17-10)3-11(13)14/h1-2,7,12H,3-4H2 |
| InChIKey | MUZDESIPVDAQDE-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.98 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|