C26H22F6N7O6+ — CID 140804521
[(3aS,4S,9S,10aS)-2,6-diamino-4-[(1,3-dioxoisoindol-2-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-3-ium-9-yl] 2,5-bis(trifluoromethyl)benzoate (PubChem CID 140804521) has the molecular formula C26H22F6N7O6+ and a molecular weight of 642.49 g/mol. Its IUPAC name is [(3aS,4S,9S,10aS)-2,6-diamino-4-[(1,3-dioxoisoindol-2-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-3-ium-9-yl] 2,5-bis(trifluoromethyl)benzoate.
| Compound Name | [(3aS,4S,9S,10aS)-2,6-diamino-4-[(1,3-dioxoisoindol-2-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-3-ium-9-yl] 2,5-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 140804521 |
| Molecular Formula | C26H22F6N7O6+ |
| Molecular Weight | 642.49 g/mol |
| Exact Mass | 642.15 |
| IUPAC Name | [(3aS,4S,9S,10aS)-2,6-diamino-4-[(1,3-dioxoisoindol-2-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-3-ium-9-yl] 2,5-bis(trifluoromethyl)benzoate |
| SMILES | NC1=N[C@@H](CN2C(=O)c3ccccc3C2=O)[C@@H]2[NH+]=C(N)N[C@]23N1C[C@H](OC(=O)c1cc(C(F)(F)F)ccc1C(F)(F)F)C3(O)O |
| InChI | InChI=1S/C26H21F6N7O6/c27-25(28,29)10-5-6-14(26(30,31)32)13(7-10)20(42)45-16-9-39-22(34)35-15(17-23(39,24(16,43)44)37-21(33)36-17)8-38-18(40)11-3-1-2-4-12(11)19(38)41/h1-7,15-17,43-44H,8-9H2,(H2,34,35)(H3,33,36,37)/p+1/t15-,16-,17-,23-/m0/s1 |
| InChIKey | BTRGMJDPUSNCAR-DSFVOBFGSA-O |
| XLogP | -1.70 |
| TPSA | 197.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.49 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|