C29H40BN3O7 — CID 140809181
methyl N-[(2S)-3-methyl-1-oxo-1-[(8S)-8-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl]butan-2-yl]carbamate (PubChem CID 140809181) has the molecular formula C29H40BN3O7 and a molecular weight of 553.47 g/mol. Its IUPAC name is methyl N-[(2S)-3-methyl-1-oxo-1-[(8S)-8-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl]butan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-3-methyl-1-oxo-1-[(8S)-8-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 140809181 |
| Molecular Formula | C29H40BN3O7 |
| Molecular Weight | 553.47 g/mol |
| Exact Mass | 553.30 |
| IUPAC Name | methyl N-[(2S)-3-methyl-1-oxo-1-[(8S)-8-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]-1,4-dioxa-7-azaspiro[4.4]nonan-7-yl]butan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N1CC2(C[C@H]1C1=NC=C(c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)C1)OCCO2)C(C)C |
| InChI | InChI=1S/C29H40BN3O7/c1-18(2)24(32-26(35)36-7)25(34)33-17-29(37-12-13-38-29)15-23(33)22-14-20(16-31-22)19-8-10-21(11-9-19)30-39-27(3,4)28(5,6)40-30/h8-11,16,18,23-24H,12-15,17H2,1-7H3,(H,32,35)/t23-,24-/m0/s1 |
| InChIKey | QDDJLFYGEYRNDI-ZEQRLZLVSA-N |
| XLogP | 2.90 |
| TPSA | 107.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|