C27H38N5O7P — CID 140822403
[(3aR,4R,6R,6aR)-4-[6-(3-aminophenyl)purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl ditert-butyl phosphate (PubChem CID 140822403) has the molecular formula C27H38N5O7P and a molecular weight of 575.60 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-4-[6-(3-aminophenyl)purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl ditert-butyl phosphate.
| Compound Name | [(3aR,4R,6R,6aR)-4-[6-(3-aminophenyl)purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl ditert-butyl phosphate |
|---|---|
| PubChem CID | 140822403 |
| Molecular Formula | C27H38N5O7P |
| Molecular Weight | 575.60 g/mol |
| Exact Mass | 575.25 |
| IUPAC Name | [(3aR,4R,6R,6aR)-4-[6-(3-aminophenyl)purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl ditert-butyl phosphate |
| SMILES | CC(C)(C)OP(=O)(OC[C@H]1O[C@@H](n2cnc3c(-c4cccc(N)c4)ncnc32)[C@@H]2OC(C)(C)O[C@@H]21)OC(C)(C)C |
| InChI | InChI=1S/C27H38N5O7P/c1-25(2,3)38-40(33,39-26(4,5)6)34-13-18-21-22(37-27(7,8)36-21)24(35-18)32-15-31-20-19(29-14-30-23(20)32)16-10-9-11-17(28)12-16/h9-12,14-15,18,21-22,24H,13,28H2,1-8H3/t18-,21-,22-,24-/m1/s1 |
| InChIKey | VURMJFNUAPHLSY-QMBPOEKNSA-N |
| XLogP | 5.25 |
| TPSA | 142.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.60 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|