C9H12O5Si — CID 140826895
2,3-dihydro-1,4-benzodioxin-6-ylmethyl(tritritiooxy)silane (PubChem CID 140826895) has the molecular formula C9H12O5Si and a molecular weight of 234.30 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-6-ylmethyl(tritritiooxy)silane.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-6-ylmethyl(tritritiooxy)silane |
|---|---|
| PubChem CID | 140826895 |
| Molecular Formula | C9H12O5Si |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-6-ylmethyl(tritritiooxy)silane |
| SMILES | [3H]O[Si](Cc1ccc2c(c1)OCCO2)(O[3H])O[3H] |
| InChI | InChI=1S/C9H12O5Si/c10-15(11,12)6-7-1-2-8-9(5-7)14-4-3-13-8/h1-2,5,10-12H,3-4,6H2/i10T,11T,12T |
| InChIKey | GFWDVSBLAUHTHT-BRIOIKEISA-N |
| XLogP | -0.54 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|