C17H11ClF3NO7 — CID 140847103
2-hydroxypropanoyl 5-[3-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate (PubChem CID 140847103) has the molecular formula C17H11ClF3NO7 and a molecular weight of 433.72 g/mol. Its IUPAC name is 2-hydroxypropanoyl 5-[3-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate.
| Compound Name | 2-hydroxypropanoyl 5-[3-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
|---|---|
| PubChem CID | 140847103 |
| Molecular Formula | C17H11ClF3NO7 |
| Molecular Weight | 433.72 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | 2-hydroxypropanoyl 5-[3-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
| SMILES | CC(O)C(=O)OC(=O)c1cc(Oc2ccc(C(F)(F)F)c(Cl)c2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H11ClF3NO7/c1-8(23)15(24)29-16(25)11-6-9(3-5-14(11)22(26)27)28-10-2-4-12(13(18)7-10)17(19,20)21/h2-8,23H,1H3 |
| InChIKey | NIKPLLDFASVVFH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.72 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|