C32H29N5O6S — CID 140861110
4-[2-[4-(5,5-dimethyl-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl)phenoxy]ethylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 140861110) has the molecular formula C32H29N5O6S and a molecular weight of 611.68 g/mol. Its IUPAC name is 4-[2-[4-(5,5-dimethyl-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl)phenoxy]ethylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[2-[4-(5,5-dimethyl-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl)phenoxy]ethylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 140861110 |
| Molecular Formula | C32H29N5O6S |
| Molecular Weight | 611.68 g/mol |
| Exact Mass | 611.18 |
| IUPAC Name | 4-[2-[4-(5,5-dimethyl-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl)phenoxy]ethylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CC1(C)C(=O)N(c2ccccc2)C(=S)N1c1ccc(OCCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C32H29N5O6S/c1-32(2)30(42)35(19-7-4-3-5-8-19)31(44)37(32)20-11-13-21(14-12-20)43-18-17-33-23-10-6-9-22-26(23)29(41)36(28(22)40)24-15-16-25(38)34-27(24)39/h3-14,24,33H,15-18H2,1-2H3,(H,34,38,39) |
| InChIKey | JZKJOFLKIWZQGO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.68 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|