C4H6Br2N2O4 — CID 14089016
1,4-dibromo-1,4-dinitrobutane (PubChem CID 14089016) has the molecular formula C4H6Br2N2O4 and a molecular weight of 305.91 g/mol. Its IUPAC name is 1,4-dibromo-1,4-dinitrobutane.
| Compound Name | 1,4-dibromo-1,4-dinitrobutane |
|---|---|
| PubChem CID | 14089016 |
| Molecular Formula | C4H6Br2N2O4 |
| Molecular Weight | 305.91 g/mol |
| Exact Mass | 303.87 |
| IUPAC Name | 1,4-dibromo-1,4-dinitrobutane |
| SMILES | O=[N+]([O-])C(Br)CCC(Br)[N+](=O)[O-] |
| InChI | InChI=1S/C4H6Br2N2O4/c5-3(7(9)10)1-2-4(6)8(11)12/h3-4H,1-2H2 |
| InChIKey | BTRADJNUBHHBHV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.91 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|