C11H20O9 — CID 140898581
(4S,5R,6R,7S,8R)-8,9-bis(deuteriomethoxy)-4,5,6,7-tetrahydroxy-2-oxononanoic acid (PubChem CID 140898581) has the molecular formula C11H20O9 and a molecular weight of 298.28 g/mol. Its IUPAC name is (4S,5R,6R,7S,8R)-8,9-bis(deuteriomethoxy)-4,5,6,7-tetrahydroxy-2-oxononanoic acid.
| Compound Name | (4S,5R,6R,7S,8R)-8,9-bis(deuteriomethoxy)-4,5,6,7-tetrahydroxy-2-oxononanoic acid |
|---|---|
| PubChem CID | 140898581 |
| Molecular Formula | C11H20O9 |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (4S,5R,6R,7S,8R)-8,9-bis(deuteriomethoxy)-4,5,6,7-tetrahydroxy-2-oxononanoic acid |
| SMILES | [2H]COC[C@@H](OC[2H])[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)CC(=O)C(=O)O |
| InChI | InChI=1S/C11H20O9/c1-19-4-7(20-2)9(15)10(16)8(14)5(12)3-6(13)11(17)18/h5,7-10,12,14-16H,3-4H2,1-2H3,(H,17,18)/t5-,7+,8+,9+,10+/m0/s1/i1D,2D |
| InChIKey | CUMUYPGKBBNJIA-LLEFUPNTSA-N |
| XLogP | -2.86 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|