C29H44O3 — CID 140945138
(4,4-dimethyl-3-oxopentan-2-yl) (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 140945138) has the molecular formula C29H44O3 and a molecular weight of 440.67 g/mol. Its IUPAC name is (4,4-dimethyl-3-oxopentan-2-yl) (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | (4,4-dimethyl-3-oxopentan-2-yl) (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 140945138 |
| Molecular Formula | C29H44O3 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | (4,4-dimethyl-3-oxopentan-2-yl) (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OC(C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C29H44O3/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-27(30)32-26(2)28(31)29(3,4)5/h7-8,10-11,13-14,16-17,19-20,22-23,26H,6,9,12,15,18,21,24-25H2,1-5H3/b8-7-,11-10-,14-13-,17-16-,20-19-,23-22- |
| InChIKey | IHEYSZGGFQKISK-XTJKPUCJSA-N |
| XLogP | 8.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|