C11H11N3O2 — CID 140972935
2,3,4,4a,5,10a-hexahydropyridazino[4,5-b]quinoline-1,10-dione (PubChem CID 140972935) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is 2,3,4,4a,5,10a-hexahydropyridazino[4,5-b]quinoline-1,10-dione.
| Compound Name | 2,3,4,4a,5,10a-hexahydropyridazino[4,5-b]quinoline-1,10-dione |
|---|---|
| PubChem CID | 140972935 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2,3,4,4a,5,10a-hexahydropyridazino[4,5-b]quinoline-1,10-dione |
| SMILES | O=C1NNCC2Nc3ccccc3C(=O)C12 |
| InChI | InChI=1S/C11H11N3O2/c15-10-6-3-1-2-4-7(6)13-8-5-12-14-11(16)9(8)10/h1-4,8-9,12-13H,5H2,(H,14,16) |
| InChIKey | ZJFIVQAKPCIRTJ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|