C5H10FNO2 — CID 141010456
3-fluoropiperidine-2,6-diol (PubChem CID 141010456) has the molecular formula C5H10FNO2 and a molecular weight of 135.14 g/mol. Its IUPAC name is 3-fluoropiperidine-2,6-diol.
| Compound Name | 3-fluoropiperidine-2,6-diol |
|---|---|
| PubChem CID | 141010456 |
| Molecular Formula | C5H10FNO2 |
| Molecular Weight | 135.14 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 3-fluoropiperidine-2,6-diol |
| SMILES | OC1CCC(F)C(O)N1 |
| InChI | InChI=1S/C5H10FNO2/c6-3-1-2-4(8)7-5(3)9/h3-5,7-9H,1-2H2 |
| InChIKey | WXYSVOIRAYKITM-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.14 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |