C16H15ClFN3 — CID 141072900
6-chloro-1-(4-fluorophenyl)-3-(4-methylphenyl)-2,4-dihydro-1,3,5-triazine (PubChem CID 141072900) has the molecular formula C16H15ClFN3 and a molecular weight of 303.77 g/mol. Its IUPAC name is 6-chloro-1-(4-fluorophenyl)-3-(4-methylphenyl)-2,4-dihydro-1,3,5-triazine.
| Compound Name | 6-chloro-1-(4-fluorophenyl)-3-(4-methylphenyl)-2,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 141072900 |
| Molecular Formula | C16H15ClFN3 |
| Molecular Weight | 303.77 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 6-chloro-1-(4-fluorophenyl)-3-(4-methylphenyl)-2,4-dihydro-1,3,5-triazine |
| SMILES | Cc1ccc(N2CN=C(Cl)N(c3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C16H15ClFN3/c1-12-2-6-14(7-3-12)20-10-19-16(17)21(11-20)15-8-4-13(18)5-9-15/h2-9H,10-11H2,1H3 |
| InChIKey | HNKDYRDGGODKOL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.77 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|