C7H11NO4S — CID 141075400
(3R,4R,5R,6S)-2-isothiocyanato-6-methyloxane-3,4,5-triol (PubChem CID 141075400) has the molecular formula C7H11NO4S and a molecular weight of 205.23 g/mol. Its IUPAC name is (3R,4R,5R,6S)-2-isothiocyanato-6-methyloxane-3,4,5-triol.
| Compound Name | (3R,4R,5R,6S)-2-isothiocyanato-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 141075400 |
| Molecular Formula | C7H11NO4S |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | (3R,4R,5R,6S)-2-isothiocyanato-6-methyloxane-3,4,5-triol |
| SMILES | C[C@@H]1OC(N=C=S)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C7H11NO4S/c1-3-4(9)5(10)6(11)7(12-3)8-2-13/h3-7,9-11H,1H3/t3-,4-,5+,6+,7?/m0/s1 |
| InChIKey | WJCHGTOQJRVIPB-UISSTJQFSA-N |
| XLogP | -1.08 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|