CH4O4Si2 — CID 141079253
4-hydroxy-4-methyl-1,3,2,4-dioxadisiletane 2-oxide (PubChem CID 141079253) has the molecular formula CH4O4Si2 and a molecular weight of 136.21 g/mol. Its IUPAC name is 4-hydroxy-4-methyl-1,3,2,4-dioxadisiletane 2-oxide.
| Compound Name | 4-hydroxy-4-methyl-1,3,2,4-dioxadisiletane 2-oxide |
|---|---|
| PubChem CID | 141079253 |
| Molecular Formula | CH4O4Si2 |
| Molecular Weight | 136.21 g/mol |
| Exact Mass | 135.96 |
| IUPAC Name | 4-hydroxy-4-methyl-1,3,2,4-dioxadisiletane 2-oxide |
| SMILES | C[Si]1(O)O[Si](=O)O1 |
| InChI | InChI=1S/CH4O4Si2/c1-7(3)4-6(2)5-7/h3H,1H3 |
| InChIKey | ZAVFPICHNGKTSL-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.21 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|