C8H24Si5 — CID 170905329
(2,2-dimethyl-3-trimethylsilyltrisiliren-1-yl)-trimethylsilane (PubChem CID 170905329) has the molecular formula C8H24Si5 and a molecular weight of 260.71 g/mol. Its IUPAC name is (2,2-dimethyl-3-trimethylsilyltrisiliren-1-yl)-trimethylsilane.
| Compound Name | (2,2-dimethyl-3-trimethylsilyltrisiliren-1-yl)-trimethylsilane |
|---|---|
| PubChem CID | 170905329 |
| Molecular Formula | C8H24Si5 |
| Molecular Weight | 260.71 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | (2,2-dimethyl-3-trimethylsilyltrisiliren-1-yl)-trimethylsilane |
| SMILES | C[Si](C)(C)[Si]1=[Si]([Si](C)(C)C)[Si]1(C)C |
| InChI | InChI=1S/C8H24Si5/c1-11(2,3)9-10(12(4,5)6)13(9,7)8/h1-8H3 |
| InChIKey | GDEBLKSWHVUZDS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.71 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|