C29H30N2OS2 — CID 141165930
1,6-bis(1,3-benzothiazol-2-yl)-2,3,4,5-tetramethyl-6-pent-1-en-2-ylcyclohexa-2,4-dien-1-ol (PubChem CID 141165930) has the molecular formula C29H30N2OS2 and a molecular weight of 486.71 g/mol. Its IUPAC name is 1,6-bis(1,3-benzothiazol-2-yl)-2,3,4,5-tetramethyl-6-pent-1-en-2-ylcyclohexa-2,4-dien-1-ol.
| Compound Name | 1,6-bis(1,3-benzothiazol-2-yl)-2,3,4,5-tetramethyl-6-pent-1-en-2-ylcyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 141165930 |
| Molecular Formula | C29H30N2OS2 |
| Molecular Weight | 486.71 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 1,6-bis(1,3-benzothiazol-2-yl)-2,3,4,5-tetramethyl-6-pent-1-en-2-ylcyclohexa-2,4-dien-1-ol |
| SMILES | C=C(CCC)C1(c2nc3ccccc3s2)C(C)=C(C)C(C)=C(C)C1(O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C29H30N2OS2/c1-7-12-17(2)28(26-30-22-13-8-10-15-24(22)33-26)20(5)18(3)19(4)21(6)29(28,32)27-31-23-14-9-11-16-25(23)34-27/h8-11,13-16,32H,2,7,12H2,1,3-6H3 |
| InChIKey | RNWZIOUNGCZPSF-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.71 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|