C11H10ClN — CID 141260635
4-(4-chlorophenyl)-1,4-dihydropyridine (PubChem CID 141260635) has the molecular formula C11H10ClN and a molecular weight of 191.66 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1,4-dihydropyridine.
| Compound Name | 4-(4-chlorophenyl)-1,4-dihydropyridine |
|---|---|
| PubChem CID | 141260635 |
| Molecular Formula | C11H10ClN |
| Molecular Weight | 191.66 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | 4-(4-chlorophenyl)-1,4-dihydropyridine |
| SMILES | Clc1ccc(C2C=CNC=C2)cc1 |
| InChI | InChI=1S/C11H10ClN/c12-11-3-1-9(2-4-11)10-5-7-13-8-6-10/h1-8,10,13H |
| InChIKey | PFOOSSGEJSLTMC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.66 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |