C8H8ClNO2S — CID 35028553
(4S,5S)-4-(4-chlorophenyl)-1,3,2-oxathiazolidin-5-ol (PubChem CID 35028553) has the molecular formula C8H8ClNO2S and a molecular weight of 217.68 g/mol. Its IUPAC name is (4S,5S)-4-(4-chlorophenyl)-1,3,2-oxathiazolidin-5-ol.
| Compound Name | (4S,5S)-4-(4-chlorophenyl)-1,3,2-oxathiazolidin-5-ol |
|---|---|
| PubChem CID | 35028553 |
| Molecular Formula | C8H8ClNO2S |
| Molecular Weight | 217.68 g/mol |
| Exact Mass | 217.00 |
| IUPAC Name | (4S,5S)-4-(4-chlorophenyl)-1,3,2-oxathiazolidin-5-ol |
| SMILES | O[C@H]1ONS[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H8ClNO2S/c9-6-3-1-5(2-4-6)7-8(11)12-10-13-7/h1-4,7-8,10-11H/t7-,8-/m0/s1 |
| InChIKey | AZMBQDYUHOWEMO-YUMQZZPRSA-N |
| XLogP | 1.88 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.68 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|