C17H31NO15 — CID 141300449
[1-amino-1-oxo-2-(2,3,4,5,6-pentahydroxyhexanoyloxy)pentan-2-yl] 2,3,4,5,6-pentahydroxyhexanoate (PubChem CID 141300449) has the molecular formula C17H31NO15 and a molecular weight of 489.43 g/mol. Its IUPAC name is [1-amino-1-oxo-2-(2,3,4,5,6-pentahydroxyhexanoyloxy)pentan-2-yl] 2,3,4,5,6-pentahydroxyhexanoate.
| Compound Name | [1-amino-1-oxo-2-(2,3,4,5,6-pentahydroxyhexanoyloxy)pentan-2-yl] 2,3,4,5,6-pentahydroxyhexanoate |
|---|---|
| PubChem CID | 141300449 |
| Molecular Formula | C17H31NO15 |
| Molecular Weight | 489.43 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | [1-amino-1-oxo-2-(2,3,4,5,6-pentahydroxyhexanoyloxy)pentan-2-yl] 2,3,4,5,6-pentahydroxyhexanoate |
| SMILES | CCCC(OC(=O)C(O)C(O)C(O)C(O)CO)(OC(=O)C(O)C(O)C(O)C(O)CO)C(N)=O |
| InChI | InChI=1S/C17H31NO15/c1-2-3-17(16(18)31,32-14(29)12(27)10(25)8(23)6(21)4-19)33-15(30)13(28)11(26)9(24)7(22)5-20/h6-13,19-28H,2-5H2,1H3,(H2,18,31) |
| InChIKey | WDQLFWUJGSNNKS-UHFFFAOYSA-N |
| XLogP | -7.07 |
| TPSA | 297.99 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.43 |
| LogP ≤ 5 | -7.07 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|