C10H20O9 — CID 91538211
(2R,3S,4R)-1,2,3,4,6,6,7,7-octahydroxydecan-5-one (PubChem CID 91538211) has the molecular formula C10H20O9 and a molecular weight of 284.26 g/mol. Its IUPAC name is (2R,3S,4R)-1,2,3,4,6,6,7,7-octahydroxydecan-5-one.
| Compound Name | (2R,3S,4R)-1,2,3,4,6,6,7,7-octahydroxydecan-5-one |
|---|---|
| PubChem CID | 91538211 |
| Molecular Formula | C10H20O9 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | (2R,3S,4R)-1,2,3,4,6,6,7,7-octahydroxydecan-5-one |
| SMILES | CCCC(O)(O)C(O)(O)C(=O)[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H20O9/c1-2-3-9(16,17)10(18,19)8(15)7(14)6(13)5(12)4-11/h5-7,11-14,16-19H,2-4H2,1H3/t5-,6+,7-/m1/s1 |
| InChIKey | DTDWOCNZQKUOHL-DSYKOEDSSA-N |
| XLogP | -4.21 |
| TPSA | 178.91 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | -4.21 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|