C16H19N3O2S — CID 141314453
2-[1-(2,2-diethoxyethyl)imidazol-4-yl]thieno[3,2-b]pyridine (PubChem CID 141314453) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is 2-[1-(2,2-diethoxyethyl)imidazol-4-yl]thieno[3,2-b]pyridine.
| Compound Name | 2-[1-(2,2-diethoxyethyl)imidazol-4-yl]thieno[3,2-b]pyridine |
|---|---|
| PubChem CID | 141314453 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-[1-(2,2-diethoxyethyl)imidazol-4-yl]thieno[3,2-b]pyridine |
| SMILES | CCOC(Cn1cnc(-c2cc3ncccc3s2)c1)OCC |
| InChI | InChI=1S/C16H19N3O2S/c1-3-20-16(21-4-2)10-19-9-13(18-11-19)15-8-12-14(22-15)6-5-7-17-12/h5-9,11,16H,3-4,10H2,1-2H3 |
| InChIKey | LNYNSFPCFMXAHK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|