C6H2ClFO2 — CID 141421200
5-chloro-4-fluoro-7-oxabicyclo[4.1.0]hepta-1(6),2,4-trien-3-ol (PubChem CID 141421200) has the molecular formula C6H2ClFO2 and a molecular weight of 160.53 g/mol. Its IUPAC name is 5-chloro-4-fluoro-7-oxabicyclo[4.1.0]hepta-1(6),2,4-trien-3-ol.
| Compound Name | 5-chloro-4-fluoro-7-oxabicyclo[4.1.0]hepta-1(6),2,4-trien-3-ol |
|---|---|
| PubChem CID | 141421200 |
| Molecular Formula | C6H2ClFO2 |
| Molecular Weight | 160.53 g/mol |
| Exact Mass | 159.97 |
| IUPAC Name | 5-chloro-4-fluoro-7-oxabicyclo[4.1.0]hepta-1(6),2,4-trien-3-ol |
| SMILES | Oc1cc2c(c(Cl)c1F)O2 |
| InChI | InChI=1S/C6H2ClFO2/c7-4-5(8)2(9)1-3-6(4)10-3/h1,9H |
| InChIKey | RYOBRKQODXQALX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.53 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|