C23H31BN2O4S — CID 141448910
1-[1-methyl-3-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-yl]sulfonylindazole (PubChem CID 141448910) has the molecular formula C23H31BN2O4S and a molecular weight of 442.39 g/mol. Its IUPAC name is 1-[1-methyl-3-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-yl]sulfonylindazole.
| Compound Name | 1-[1-methyl-3-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-yl]sulfonylindazole |
|---|---|
| PubChem CID | 141448910 |
| Molecular Formula | C23H31BN2O4S |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 1-[1-methyl-3-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-yl]sulfonylindazole |
| SMILES | CC(C)C1=CC(C)(S(=O)(=O)n2ncc3ccccc32)CC=C1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C23H31BN2O4S/c1-16(2)18-14-23(7,13-12-19(18)24-29-21(3,4)22(5,6)30-24)31(27,28)26-20-11-9-8-10-17(20)15-25-26/h8-12,14-16H,13H2,1-7H3 |
| InChIKey | HWYHLPSQIZUDAK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|