C51H38N8O5 — CID 141478474
(1E,6E)-3,5-bis[4-(9-benzylpurin-6-yl)oxyphenyl]-1,7-bis(furan-2-yl)hepta-1,6-dien-4-one (PubChem CID 141478474) has the molecular formula C51H38N8O5 and a molecular weight of 842.92 g/mol. Its IUPAC name is (1E,6E)-3,5-bis[4-(9-benzylpurin-6-yl)oxyphenyl]-1,7-bis(furan-2-yl)hepta-1,6-dien-4-one.
| Compound Name | (1E,6E)-3,5-bis[4-(9-benzylpurin-6-yl)oxyphenyl]-1,7-bis(furan-2-yl)hepta-1,6-dien-4-one |
|---|---|
| PubChem CID | 141478474 |
| Molecular Formula | C51H38N8O5 |
| Molecular Weight | 842.92 g/mol |
| Exact Mass | 842.30 |
| IUPAC Name | (1E,6E)-3,5-bis[4-(9-benzylpurin-6-yl)oxyphenyl]-1,7-bis(furan-2-yl)hepta-1,6-dien-4-one |
| SMILES | O=C(C(/C=C/c1ccco1)c1ccc(Oc2ncnc3c2ncn3Cc2ccccc2)cc1)C(/C=C/c1ccco1)c1ccc(Oc2ncnc3c2ncn3Cc2ccccc2)cc1 |
| InChI | InChI=1S/C51H38N8O5/c60-47(43(25-23-39-13-7-27-61-39)37-15-19-41(20-16-37)63-50-45-48(52-31-54-50)58(33-56-45)29-35-9-3-1-4-10-35)44(26-24-40-14-8-28-62-40)38-17-21-42(22-18-38)64-51-46-49(53-32-55-51)59(34-57-46)30-36-11-5-2-6-12-36/h1-28,31-34,43-44H,29-30H2/b25-23+,26-24+ |
| InChIKey | OWSDIUMZDWJIKR-OGGGYYITSA-N |
| XLogP | 10.70 |
| TPSA | 149.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.92 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |