C9H10N4 — CID 141479420
5-azido-2,3-dihydro-1H-inden-4-amine (PubChem CID 141479420) has the molecular formula C9H10N4 and a molecular weight of 174.21 g/mol. Its IUPAC name is 5-azido-2,3-dihydro-1H-inden-4-amine.
| Compound Name | 5-azido-2,3-dihydro-1H-inden-4-amine |
|---|---|
| PubChem CID | 141479420 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 5-azido-2,3-dihydro-1H-inden-4-amine |
| SMILES | [N-]=[N+]=Nc1ccc2c(c1N)CCC2 |
| InChI | InChI=1S/C9H10N4/c10-9-7-3-1-2-6(7)4-5-8(9)12-13-11/h4-5H,1-3,10H2 |
| InChIKey | HSFGFOUOSZDTAM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|