C11H12ClN5 — CID 141495401
5-chloro-1-N,1-N-dimethyl-4-(1,3,5-triazin-2-yl)benzene-1,3-diamine (PubChem CID 141495401) has the molecular formula C11H12ClN5 and a molecular weight of 249.71 g/mol. Its IUPAC name is 5-chloro-1-N,1-N-dimethyl-4-(1,3,5-triazin-2-yl)benzene-1,3-diamine.
| Compound Name | 5-chloro-1-N,1-N-dimethyl-4-(1,3,5-triazin-2-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 141495401 |
| Molecular Formula | C11H12ClN5 |
| Molecular Weight | 249.71 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 5-chloro-1-N,1-N-dimethyl-4-(1,3,5-triazin-2-yl)benzene-1,3-diamine |
| SMILES | CN(C)c1cc(N)c(-c2ncncn2)c(Cl)c1 |
| InChI | InChI=1S/C11H12ClN5/c1-17(2)7-3-8(12)10(9(13)4-7)11-15-5-14-6-16-11/h3-6H,13H2,1-2H3 |
| InChIKey | IAXIIKHMARDJII-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.71 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|