C48H33Cl4N5O — CID 141496640
4-[5,10,15,20-tetrakis(4-chlorophenyl)-21,23-dihydroporphyrin-2-yl]morpholine (PubChem CID 141496640) has the molecular formula C48H33Cl4N5O and a molecular weight of 837.64 g/mol. Its IUPAC name is 4-[5,10,15,20-tetrakis(4-chlorophenyl)-21,23-dihydroporphyrin-2-yl]morpholine.
| Compound Name | 4-[5,10,15,20-tetrakis(4-chlorophenyl)-21,23-dihydroporphyrin-2-yl]morpholine |
|---|---|
| PubChem CID | 141496640 |
| Molecular Formula | C48H33Cl4N5O |
| Molecular Weight | 837.64 g/mol |
| Exact Mass | 835.14 |
| IUPAC Name | 4-[5,10,15,20-tetrakis(4-chlorophenyl)-21,23-dihydroporphyrin-2-yl]morpholine |
| SMILES | Clc1ccc(-c2c3nc(c(-c4ccc(Cl)cc4)c4cc(N5CCOCC5)c([nH]4)c(-c4ccc(Cl)cc4)c4nc(c(-c5ccc(Cl)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C48H33Cl4N5O/c49-32-9-1-28(2-10-32)44-36-17-18-37(53-36)45(29-3-11-33(50)12-4-29)39-21-22-41(55-39)47(31-7-15-35(52)16-8-31)48-43(57-23-25-58-26-24-57)27-42(56-48)46(40-20-19-38(44)54-40)30-5-13-34(51)14-6-30/h1-22,27,53,56H,23-26H2/b44-36-,44-38-,45-37-,45-39-,46-40-,46-42-,47-41-,48-47- |
| InChIKey | HIBKLOPMGBZRGM-ZDMNOSTMSA-N |
| XLogP | 13.77 |
| TPSA | 69.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.64 |
| LogP ≤ 5 | 13.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |