About CID 14173064
CID 14173064 (PubChem CID 14173064) has the molecular formula C7Cl4F5NP-
and a molecular weight of 365.86 g/mol.
Molecular Properties
| Compound Name | CID 14173064 |
| PubChem CID | 14173064 |
| Molecular Formula | C7Cl4F5NP- |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 363.84 |
| IUPAC Name | — |
| SMILES | N#C[P-](Cl)(Cl)(Cl)(Cl)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C7Cl4F5NP/c8-18(9,10,11,1-17)7-5(15)3(13)2(12)4(14)6(7)16/q-1 |
| InChIKey | VRJLYJKTPBQFCB-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 14173064 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 14173064?
The IUPAC name of CID 14173064 (CID 14173064) is not available.
What is the SMILES notation for CID 14173064?
The canonical SMILES for CID 14173064 is N#C[P-](Cl)(Cl)(Cl)(Cl)c1c(F)c(F)c(F)c(F)c1F.
What is the InChIKey of CID 14173064?
The InChIKey is VRJLYJKTPBQFCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7Cl4F5NP/c8-18(9,10,11,1-17)7-5(15)3(13)2(12)4(14)6(7)16/q-1.
What are the key properties of CID 14173064?
CID 14173064 has a molecular weight of 365.86 g/mol, XLogP of 5.19, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 14173064 is sourced from PubChem (CID 14173064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).