C17H27NO — CID 141909239
(3E,4E,5Z,7Z)-4-ethylidene-3-[1-[ethyl(methyl)amino]ethylidene]deca-5,7-dien-2-one (PubChem CID 141909239) has the molecular formula C17H27NO and a molecular weight of 261.40 g/mol. Its IUPAC name is (3E,4E,5Z,7Z)-4-ethylidene-3-[1-[ethyl(methyl)amino]ethylidene]deca-5,7-dien-2-one.
| Compound Name | (3E,4E,5Z,7Z)-4-ethylidene-3-[1-[ethyl(methyl)amino]ethylidene]deca-5,7-dien-2-one |
|---|---|
| PubChem CID | 141909239 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.40 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | (3E,4E,5Z,7Z)-4-ethylidene-3-[1-[ethyl(methyl)amino]ethylidene]deca-5,7-dien-2-one |
| SMILES | CC/C=C\C=C/C(=C\C)/C(=C(/C)\N(C)CC)/C(=O)C |
| InChI | InChI=1S/C17H27NO/c1-7-10-11-12-13-16(8-2)17(15(5)19)14(4)18(6)9-3/h8,10-13H,7,9H2,1-6H3/b11-10-,13-12-,16-8+,17-14- |
| InChIKey | QRLDQRMKPIKWIB-VBBJZLRYSA-N |
| XLogP | 4.40 |
| TPSA | 20.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | 411 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|