C30H36N6O5S — CID 142027208
5-[[[4-[[amino(diazenyl)methylidene]carbamoyl]phenyl]methyl-(4-tert-butylphenyl)carbamoyl]amino]-2-butoxybenzenesulfinic acid (PubChem CID 142027208) has the molecular formula C30H36N6O5S and a molecular weight of 592.72 g/mol. Its IUPAC name is 5-[[[4-[[amino(diazenyl)methylidene]carbamoyl]phenyl]methyl-(4-tert-butylphenyl)carbamoyl]amino]-2-butoxybenzenesulfinic acid.
| Compound Name | 5-[[[4-[[amino(diazenyl)methylidene]carbamoyl]phenyl]methyl-(4-tert-butylphenyl)carbamoyl]amino]-2-butoxybenzenesulfinic acid |
|---|---|
| PubChem CID | 142027208 |
| Molecular Formula | C30H36N6O5S |
| Molecular Weight | 592.72 g/mol |
| Exact Mass | 592.25 |
| IUPAC Name | 5-[[[4-[[amino(diazenyl)methylidene]carbamoyl]phenyl]methyl-(4-tert-butylphenyl)carbamoyl]amino]-2-butoxybenzenesulfinic acid |
| SMILES | [H]/N=N/C(N)=N\C(=O)c1ccc(CN(C(=O)Nc2ccc(OCCCC)c(S(=O)O)c2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C30H36N6O5S/c1-5-6-17-41-25-16-13-23(18-26(25)42(39)40)33-29(38)36(24-14-11-22(12-15-24)30(2,3)4)19-20-7-9-21(10-8-20)27(37)34-28(31)35-32/h7-16,18,32H,5-6,17,19H2,1-4H3,(H,33,38)(H,39,40)(H2,31,34,37)/b35-32+ |
| InChIKey | VRFWTKHASWUBCH-LVYIWIAJSA-N |
| XLogP | 6.47 |
| TPSA | 170.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.72 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|