C10H14N2 — CID 142044127
2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-4,5-dihydro-1H-imidazole (PubChem CID 142044127) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-4,5-dihydro-1H-imidazole.
| Compound Name | 2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 142044127 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-4,5-dihydro-1H-imidazole |
| SMILES | C=C/C=C\C=C(/C)C1=NCCN1 |
| InChI | InChI=1S/C10H14N2/c1-3-4-5-6-9(2)10-11-7-8-12-10/h3-6H,1,7-8H2,2H3,(H,11,12)/b5-4-,9-6+ |
| InChIKey | ZSBSBLKCIGZHNO-KMOPYBJPSA-N |
| XLogP | 1.68 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|