C40H30Cl2N4O3 — CID 142081853
9-[4-[1-[4-[bis(pyridin-2-ylmethyl)amino]anilino]ethenyl]-2-methylphenyl]-2,7-dichloro-6-hydroxyxanthen-3-one (PubChem CID 142081853) has the molecular formula C40H30Cl2N4O3 and a molecular weight of 685.61 g/mol. Its IUPAC name is 9-[4-[1-[4-[bis(pyridin-2-ylmethyl)amino]anilino]ethenyl]-2-methylphenyl]-2,7-dichloro-6-hydroxyxanthen-3-one.
| Compound Name | 9-[4-[1-[4-[bis(pyridin-2-ylmethyl)amino]anilino]ethenyl]-2-methylphenyl]-2,7-dichloro-6-hydroxyxanthen-3-one |
|---|---|
| PubChem CID | 142081853 |
| Molecular Formula | C40H30Cl2N4O3 |
| Molecular Weight | 685.61 g/mol |
| Exact Mass | 684.17 |
| IUPAC Name | 9-[4-[1-[4-[bis(pyridin-2-ylmethyl)amino]anilino]ethenyl]-2-methylphenyl]-2,7-dichloro-6-hydroxyxanthen-3-one |
| SMILES | C=C(Nc1ccc(N(Cc2ccccn2)Cc2ccccn2)cc1)c1ccc(-c2c3cc(Cl)c(=O)cc-3oc3cc(O)c(Cl)cc23)c(C)c1 |
| InChI | InChI=1S/C40H30Cl2N4O3/c1-24-17-26(9-14-31(24)40-32-18-34(41)36(47)20-38(32)49-39-21-37(48)35(42)19-33(39)40)25(2)45-27-10-12-30(13-11-27)46(22-28-7-3-5-15-43-28)23-29-8-4-6-16-44-29/h3-21,45,47H,2,22-23H2,1H3 |
| InChIKey | HQOPTNKKAMAHGX-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.61 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|