C14H11F6NO3 — CID 142101235
2-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4H-1,4-oxazin-3-one (PubChem CID 142101235) has the molecular formula C14H11F6NO3 and a molecular weight of 355.23 g/mol. Its IUPAC name is 2-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4H-1,4-oxazin-3-one.
| Compound Name | 2-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4H-1,4-oxazin-3-one |
|---|---|
| PubChem CID | 142101235 |
| Molecular Formula | C14H11F6NO3 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 2-[2-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4H-1,4-oxazin-3-one |
| SMILES | O=C1NC=COC1OCCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H11F6NO3/c15-13(16,17)9-5-8(6-10(7-9)14(18,19)20)1-3-23-12-11(22)21-2-4-24-12/h2,4-7,12H,1,3H2,(H,21,22) |
| InChIKey | NPUCHQAMGJUHCQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |