C22H23F3O3 — CID 142190534
1-[(3Z,5E,7E,9E)-5,10-dimethyl-8-phenyl-2-(trifluoromethyl)-2H-oxecin-3-yl]-3-methoxyprop-2-en-1-ol (PubChem CID 142190534) has the molecular formula C22H23F3O3 and a molecular weight of 392.42 g/mol. Its IUPAC name is 1-[(3Z,5E,7E,9E)-5,10-dimethyl-8-phenyl-2-(trifluoromethyl)-2H-oxecin-3-yl]-3-methoxyprop-2-en-1-ol.
| Compound Name | 1-[(3Z,5E,7E,9E)-5,10-dimethyl-8-phenyl-2-(trifluoromethyl)-2H-oxecin-3-yl]-3-methoxyprop-2-en-1-ol |
|---|---|
| PubChem CID | 142190534 |
| Molecular Formula | C22H23F3O3 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 1-[(3Z,5E,7E,9E)-5,10-dimethyl-8-phenyl-2-(trifluoromethyl)-2H-oxecin-3-yl]-3-methoxyprop-2-en-1-ol |
| SMILES | COC=CC(O)/C1=C/C(C)=C/C=C(c2ccccc2)\C=C(/C)OC1C(F)(F)F |
| InChI | InChI=1S/C22H23F3O3/c1-15-9-10-18(17-7-5-4-6-8-17)14-16(2)28-21(22(23,24)25)19(13-15)20(26)11-12-27-3/h4-14,20-21,26H,1-3H3/b12-11?,15-9+,16-14+,18-10+,19-13- |
| InChIKey | MSESNLOZUOYNSH-WQDWVKGJSA-N |
| XLogP | 5.33 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|