C18H28F2N2O — CID 142221363
(2S,4Z,6Z)-6,7-difluoro-2-[[(E)-oct-2-enyl]amino]-4-[(Z)-prop-1-enyl]hepta-4,6-dienamide (PubChem CID 142221363) has the molecular formula C18H28F2N2O and a molecular weight of 326.43 g/mol. Its IUPAC name is (2S,4Z,6Z)-6,7-difluoro-2-[[(E)-oct-2-enyl]amino]-4-[(Z)-prop-1-enyl]hepta-4,6-dienamide.
| Compound Name | (2S,4Z,6Z)-6,7-difluoro-2-[[(E)-oct-2-enyl]amino]-4-[(Z)-prop-1-enyl]hepta-4,6-dienamide |
|---|---|
| PubChem CID | 142221363 |
| Molecular Formula | C18H28F2N2O |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | (2S,4Z,6Z)-6,7-difluoro-2-[[(E)-oct-2-enyl]amino]-4-[(Z)-prop-1-enyl]hepta-4,6-dienamide |
| SMILES | C/C=C\C(=C/C(F)=C/F)C[C@H](NC/C=C/CCCCC)C(N)=O |
| InChI | InChI=1S/C18H28F2N2O/c1-3-5-6-7-8-9-11-22-17(18(21)23)13-15(10-4-2)12-16(20)14-19/h4,8-10,12,14,17,22H,3,5-7,11,13H2,1-2H3,(H2,21,23)/b9-8+,10-4-,15-12+,16-14-/t17-/m0/s1 |
| InChIKey | VGQSCLNEOOHIRU-HYWSGVPKSA-N |
| XLogP | 4.24 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|