C21H36O — CID 142231112
ethane;[(5E,7Z)-7-ethenoxy-5-methyl-3-methylidenenona-5,7-dienyl]cyclohexane (PubChem CID 142231112) has the molecular formula C21H36O and a molecular weight of 304.52 g/mol. Its IUPAC name is ethane;[(5E,7Z)-7-ethenoxy-5-methyl-3-methylidenenona-5,7-dienyl]cyclohexane.
| Compound Name | ethane;[(5E,7Z)-7-ethenoxy-5-methyl-3-methylidenenona-5,7-dienyl]cyclohexane |
|---|---|
| PubChem CID | 142231112 |
| Molecular Formula | C21H36O |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.28 |
| IUPAC Name | ethane;[(5E,7Z)-7-ethenoxy-5-methyl-3-methylidenenona-5,7-dienyl]cyclohexane |
| SMILES | C=COC(=C\C)/C=C(\C)CC(=C)CCC1CCCCC1.CC |
| InChI | InChI=1S/C19H30O.C2H6/c1-5-19(20-6-2)15-17(4)14-16(3)12-13-18-10-8-7-9-11-18;1-2/h5-6,15,18H,2-3,7-14H2,1,4H3;1-2H3/b17-15+,19-5-; |
| InChIKey | ZPIIVMXUKCAQNI-YFMSEWSSSA-N |
| XLogP | 7.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|