C38H45F2N3O3 — CID 142242228
1-N-[4-[[(1E,6Z)-cycloocta-1,3,6-trien-1-yl]methylamino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-ethynyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide;prop-1-yne (PubChem CID 142242228) has the molecular formula C38H45F2N3O3 and a molecular weight of 629.79 g/mol. Its IUPAC name is 1-N-[4-[[(1E,6Z)-cycloocta-1,3,6-trien-1-yl]methylamino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-ethynyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide;prop-1-yne.
| Compound Name | 1-N-[4-[[(1E,6Z)-cycloocta-1,3,6-trien-1-yl]methylamino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-ethynyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide;prop-1-yne |
|---|---|
| PubChem CID | 142242228 |
| Molecular Formula | C38H45F2N3O3 |
| Molecular Weight | 629.79 g/mol |
| Exact Mass | 629.34 |
| IUPAC Name | 1-N-[4-[[(1E,6Z)-cycloocta-1,3,6-trien-1-yl]methylamino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-ethynyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide;prop-1-yne |
| SMILES | C#CC.C#Cc1cc(C(=O)NC(Cc2cc(F)cc(F)c2)C(O)CNC/C2=C/C=CC/C=C\C2)cc(C(=O)N(CCC)CCC)c1 |
| InChI | InChI=1S/C35H41F2N3O3.C3H4/c1-4-14-40(15-5-2)35(43)29-17-25(6-3)16-28(21-29)34(42)39-32(20-27-18-30(36)22-31(37)19-27)33(41)24-38-23-26-12-10-8-7-9-11-13-26;1-3-2/h3,8-12,16-19,21-22,32-33,38,41H,4-5,7,13-15,20,23-24H2,1-2H3,(H,39,42);1H,2H3/b10-8?,11-9-,26-12+; |
| InChIKey | MEDCFOYCPHUKDL-YBSBHGDISA-N |
| XLogP | 5.97 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.79 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|