C27H23Cl2N4O5S+ — CID 142255094
(Z)-[[3,5-bis(methoxycarbonyl)anilino]-sulfanylmethylidene]-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]azanium (PubChem CID 142255094) has the molecular formula C27H23Cl2N4O5S+ and a molecular weight of 586.48 g/mol. Its IUPAC name is (Z)-[[3,5-bis(methoxycarbonyl)anilino]-sulfanylmethylidene]-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]azanium.
| Compound Name | (Z)-[[3,5-bis(methoxycarbonyl)anilino]-sulfanylmethylidene]-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]azanium |
|---|---|
| PubChem CID | 142255094 |
| Molecular Formula | C27H23Cl2N4O5S+ |
| Molecular Weight | 586.48 g/mol |
| Exact Mass | 585.08 |
| IUPAC Name | (Z)-[[3,5-bis(methoxycarbonyl)anilino]-sulfanylmethylidene]-[7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-1,4-benzodiazepin-3-yl]azanium |
| SMILES | COC(=O)c1cc(N/C(S)=[NH+]/C2N=C(c3ccccc3Cl)c3cc(Cl)ccc3N(C)C2=O)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C27H22Cl2N4O5S/c1-33-21-9-8-16(28)13-19(21)22(18-6-4-5-7-20(18)29)31-23(24(33)34)32-27(39)30-17-11-14(25(35)37-2)10-15(12-17)26(36)38-3/h4-13,23H,1-3H3,(H2,30,32,39)/p+1 |
| InChIKey | NIXVMIXBLVEGSH-UHFFFAOYSA-O |
| XLogP | 3.18 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|