C38H61N3O4 — CID 142263565
(3-tert-butyl-4-hydroxy-5-methanimidoylphenyl) formate;2,4-ditert-butyl-6-(heptan-4-yliminomethyl)phenol;N-methylprop-2-en-1-amine (PubChem CID 142263565) has the molecular formula C38H61N3O4 and a molecular weight of 623.92 g/mol. Its IUPAC name is (3-tert-butyl-4-hydroxy-5-methanimidoylphenyl) formate;2,4-ditert-butyl-6-(heptan-4-yliminomethyl)phenol;N-methylprop-2-en-1-amine.
| Compound Name | (3-tert-butyl-4-hydroxy-5-methanimidoylphenyl) formate;2,4-ditert-butyl-6-(heptan-4-yliminomethyl)phenol;N-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 142263565 |
| Molecular Formula | C38H61N3O4 |
| Molecular Weight | 623.92 g/mol |
| Exact Mass | 623.47 |
| IUPAC Name | (3-tert-butyl-4-hydroxy-5-methanimidoylphenyl) formate;2,4-ditert-butyl-6-(heptan-4-yliminomethyl)phenol;N-methylprop-2-en-1-amine |
| SMILES | C=CCNC.CCCC(CCC)/N=C/c1cc(C(C)(C)C)cc(C(C)(C)C)c1O.[H]/N=C/c1cc(OC=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C22H37NO.C12H15NO3.C4H9N/c1-9-11-18(12-10-2)23-15-16-13-17(21(3,4)5)14-19(20(16)24)22(6,7)8;1-12(2,3)10-5-9(16-7-14)4-8(6-13)11(10)15;1-3-4-5-2/h13-15,18,24H,9-12H2,1-8H3;4-7,13,15H,1-3H3;3,5H,1,4H2,2H3/b23-15+;13-6+; |
| InChIKey | GVSYFXUSIQYFTM-GOTTXXCESA-N |
| XLogP | 8.99 |
| TPSA | 115.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.92 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|